C23H32NO6S2+ — CID 11307878
[(3R)-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 11307878) has the molecular formula C23H32NO6S2+ and a molecular weight of 482.64 g/mol. Its IUPAC name is [(3R)-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3R)-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 11307878 |
| Molecular Formula | C23H32NO6S2+ |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [(3R)-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(O[C@H]1C[N+]2(CCOCCOCCO)CCC1CC2)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C23H32NO6S2/c25-10-12-29-14-13-28-11-9-24-7-5-18(6-8-24)19(17-24)30-22(26)23(27,20-3-1-15-31-20)21-4-2-16-32-21/h1-4,15-16,18-19,25,27H,5-14,17H2/q+1/t18?,19-,24?/m0/s1 |
| InChIKey | XBLZTUXAAMVHRP-SZTYLXMGSA-N |
| XLogP | 2.22 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|