C26H34BrNO4S — CID 69091748
[1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide (PubChem CID 69091748) has the molecular formula C26H34BrNO4S and a molecular weight of 536.53 g/mol. Its IUPAC name is [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide.
| Compound Name | [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 69091748 |
| Molecular Formula | C26H34BrNO4S |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide |
| SMILES | O=C(OC1C[N+]2(CCOc3ccccc3)CCC1CC2)[C@](O)(c1cccs1)C1CCCC1.[Br-] |
| InChI | InChI=1S/C26H34NO4S.BrH/c28-25(26(29,21-7-4-5-8-21)24-11-6-18-32-24)31-23-19-27(14-12-20(23)13-15-27)16-17-30-22-9-2-1-3-10-22;/h1-3,6,9-11,18,20-21,23,29H,4-5,7-8,12-17,19H2;1H/q+1;/p-1/t20?,23?,26-,27?;/m1./s1 |
| InChIKey | HDHXECMEKVQENC-NZBZQEQZSA-M |
| XLogP | 1.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|