C27H36NO3S2+ — CID 90998860
[1-(3-phenylsulfanylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 90998860) has the molecular formula C27H36NO3S2+ and a molecular weight of 486.72 g/mol. Its IUPAC name is [1-(3-phenylsulfanylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | [1-(3-phenylsulfanylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 90998860 |
| Molecular Formula | C27H36NO3S2+ |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [1-(3-phenylsulfanylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | O=C(OC1C[N+]2(CCCSc3ccccc3)CCC1CC2)[C@](O)(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C27H36NO3S2/c29-26(27(30,22-8-4-5-9-22)25-12-6-18-33-25)31-24-20-28(16-13-21(24)14-17-28)15-7-19-32-23-10-2-1-3-11-23/h1-3,6,10-12,18,21-22,24,30H,4-5,7-9,13-17,19-20H2/q+1/t21?,24?,27-,28?/m1/s1 |
| InChIKey | XVWUOYDOOGYDFZ-KFDGHWEOSA-N |
| XLogP | 5.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|