C31H41F3N2O6S — CID 66959435
[(3R)-1-[3-[3-(dimethylamino)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;2,2,2-trifluoroacetate (PubChem CID 66959435) has the molecular formula C31H41F3N2O6S and a molecular weight of 626.74 g/mol. Its IUPAC name is [(3R)-1-[3-[3-(dimethylamino)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-[3-[3-(dimethylamino)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66959435 |
| Molecular Formula | C31H41F3N2O6S |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | [(3R)-1-[3-[3-(dimethylamino)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;2,2,2-trifluoroacetate |
| SMILES | CN(C)c1cccc(OCCC[N+]23CCC(CC2)[C@@H](OC(=O)[C@](O)(c2cccs2)C2CCCC2)C3)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H41N2O4S.C2HF3O2/c1-30(2)24-10-5-11-25(20-24)34-18-7-15-31-16-13-22(14-17-31)26(21-31)35-28(32)29(33,23-8-3-4-9-23)27-12-6-19-36-27;3-2(4,5)1(6)7/h5-6,10-12,19-20,22-23,26,33H,3-4,7-9,13-18,21H2,1-2H3;(H,6,7)/q+1;/p-1/t22?,26-,29+,31?;/m0./s1 |
| InChIKey | PZGGZOMINHWEBL-FPECWBOSSA-M |
| XLogP | 4.11 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|