C29H38F3NO6S — CID 10145017
[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylheptanoate;2,2,2-trifluoroacetate (PubChem CID 10145017) has the molecular formula C29H38F3NO6S and a molecular weight of 585.69 g/mol. Its IUPAC name is [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylheptanoate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylheptanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10145017 |
| Molecular Formula | C29H38F3NO6S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylheptanoate;2,2,2-trifluoroacetate |
| SMILES | CCCCCC(O)(C(=O)O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)c1cccs1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H38NO4S.C2HF3O2/c1-2-3-7-15-27(30,25-12-8-20-33-25)26(29)32-24-21-28(17-13-22(24)14-18-28)16-9-19-31-23-10-5-4-6-11-23;3-2(4,5)1(6)7/h4-6,8,10-12,20,22,24,30H,2-3,7,9,13-19,21H2,1H3;(H,6,7)/q+1;/p-1/t22?,24-,27?,28?;/m0./s1 |
| InChIKey | AWBZUDUZPSVGFK-ZTYMJOMLSA-M |
| XLogP | 4.44 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|