C25H32BrNO4S — CID 10301703
[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylpent-4-enoate bromide (PubChem CID 10301703) has the molecular formula C25H32BrNO4S and a molecular weight of 522.51 g/mol. Its IUPAC name is [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylpent-4-enoate bromide.
| Compound Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylpent-4-enoate bromide |
|---|---|
| PubChem CID | 10301703 |
| Molecular Formula | C25H32BrNO4S |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylpent-4-enoate bromide |
| SMILES | C=CCC(O)(C(=O)O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)c1cccs1.[Br-] |
| InChI | InChI=1S/C25H32NO4S.BrH/c1-2-13-25(28,23-10-6-18-31-23)24(27)30-22-19-26(15-11-20(22)12-16-26)14-7-17-29-21-8-4-3-5-9-21;/h2-6,8-10,18,20,22,28H,1,7,11-17,19H2;1H/q+1;/p-1/t20?,22-,25?,26?;/m0./s1 |
| InChIKey | VNDDTXJENUQNEZ-HIJBICPQSA-M |
| XLogP | 1.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|