C26H31BrN2O3S2 — CID 10053613
2-hydroxy-N-[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]-2,2-dithiophen-2-ylacetamide bromide (PubChem CID 10053613) has the molecular formula C26H31BrN2O3S2 and a molecular weight of 563.58 g/mol. Its IUPAC name is 2-hydroxy-N-[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]-2,2-dithiophen-2-ylacetamide bromide.
| Compound Name | 2-hydroxy-N-[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]-2,2-dithiophen-2-ylacetamide bromide |
|---|---|
| PubChem CID | 10053613 |
| Molecular Formula | C26H31BrN2O3S2 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 2-hydroxy-N-[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]-2,2-dithiophen-2-ylacetamide bromide |
| SMILES | O=C(N[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)C(O)(c1cccs1)c1cccs1.[Br-] |
| InChI | InChI=1S/C26H30N2O3S2.BrH/c29-25(26(30,23-9-4-17-32-23)24-10-5-18-33-24)27-22-19-28(14-11-20(22)12-15-28)13-6-16-31-21-7-2-1-3-8-21;/h1-5,7-10,17-18,20,22,30H,6,11-16,19H2;1H/t20?,22-,28?;/m0./s1 |
| InChIKey | HMMFYOXCKMHKFL-JXJWEVJGSA-N |
| XLogP | 1.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|