C24H28NO4S2+ — CID 10437245
[(3R)-1-methyl-1-(3-phenoxypropyl)pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 10437245) has the molecular formula C24H28NO4S2+ and a molecular weight of 458.63 g/mol. Its IUPAC name is [(3R)-1-methyl-1-(3-phenoxypropyl)pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3R)-1-methyl-1-(3-phenoxypropyl)pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 10437245 |
| Molecular Formula | C24H28NO4S2+ |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [(3R)-1-methyl-1-(3-phenoxypropyl)pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | C[N+]1(CCCOc2ccccc2)CC[C@@H](OC(=O)C(O)(c2cccs2)c2cccs2)C1 |
| InChI | InChI=1S/C24H28NO4S2/c1-25(13-7-15-28-19-8-3-2-4-9-19)14-12-20(18-25)29-23(26)24(27,21-10-5-16-30-21)22-11-6-17-31-22/h2-6,8-11,16-17,20,27H,7,12-15,18H2,1H3/q+1/t20-,25?/m1/s1 |
| InChIKey | STNHWACCDKSPAG-VGOKPJQXSA-N |
| XLogP | 4.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|