C27H36NO4+ — CID 91043347
[(1S)-1-methyl-1-(3-phenoxypropyl)pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 91043347) has the molecular formula C27H36NO4+ and a molecular weight of 438.59 g/mol. Its IUPAC name is [(1S)-1-methyl-1-(3-phenoxypropyl)pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(1S)-1-methyl-1-(3-phenoxypropyl)pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 91043347 |
| Molecular Formula | C27H36NO4+ |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [(1S)-1-methyl-1-(3-phenoxypropyl)pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N@+]1(CCCOc2ccccc2)CCC(OC(=O)[C@](O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C27H36NO4/c1-28(18-10-20-31-24-15-6-3-7-16-24)19-17-25(21-28)32-26(29)27(30,23-13-8-9-14-23)22-11-4-2-5-12-22/h2-7,11-12,15-16,23,25,30H,8-10,13-14,17-21H2,1H3/q+1/t25?,27-,28-/m0/s1 |
| InChIKey | VNXSYKDPAGHUEO-UXXOXOCRSA-N |
| XLogP | 4.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|