C21H30BrNO5 — CID 87330319
[(1S,3S)-1-(2-methoxy-2-oxoethyl)-1-methylpyrrolidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (PubChem CID 87330319) has the molecular formula C21H30BrNO5 and a molecular weight of 456.38 g/mol. Its IUPAC name is [(1S,3S)-1-(2-methoxy-2-oxoethyl)-1-methylpyrrolidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide.
| Compound Name | [(1S,3S)-1-(2-methoxy-2-oxoethyl)-1-methylpyrrolidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 87330319 |
| Molecular Formula | C21H30BrNO5 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | [(1S,3S)-1-(2-methoxy-2-oxoethyl)-1-methylpyrrolidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| SMILES | COC(=O)C[N@@+]1(C)CC[C@H](OC(=O)C(O)(c2ccccc2)C2CCCC2)C1.[Br-] |
| InChI | InChI=1S/C21H30NO5.BrH/c1-22(15-19(23)26-2)13-12-18(14-22)27-20(24)21(25,17-10-6-7-11-17)16-8-4-3-5-9-16;/h3-5,8-9,17-18,25H,6-7,10-15H2,1-2H3;1H/q+1;/p-1/t18-,21?,22-;/m0./s1 |
| InChIKey | BYLYKBTVPVGVIU-QWQPSMSGSA-M |
| XLogP | -1.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|