C19H30ClNO4 — CID 54760405
[(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate;chloride;hydrate (PubChem CID 54760405) has the molecular formula C19H30ClNO4 and a molecular weight of 371.91 g/mol. Its IUPAC name is [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate;chloride;hydrate.
| Compound Name | [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate;chloride;hydrate |
|---|---|
| PubChem CID | 54760405 |
| Molecular Formula | C19H30ClNO4 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate;chloride;hydrate |
| SMILES | C[N+]1(C)CC[C@H](OC(=O)[C@](O)(c2ccccc2)C2CCCC2)C1.O.[Cl-] |
| InChI | InChI=1S/C19H28NO3.ClH.H2O/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15;;/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3;1H;1H2/q+1;;/p-1/t17-,19-;;/m0../s1 |
| InChIKey | JYZACBSSQUKDKT-FFUVTKDNSA-M |
| XLogP | -1.36 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|