C22H32NO3+ — CID 3059296
5-azoniaspiro[4.4]nonan-3-yl 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 3059296) has the molecular formula C22H32NO3+ and a molecular weight of 358.50 g/mol. Its IUPAC name is 5-azoniaspiro[4.4]nonan-3-yl 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | 5-azoniaspiro[4.4]nonan-3-yl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 3059296 |
| Molecular Formula | C22H32NO3+ |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 5-azoniaspiro[4.4]nonan-3-yl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OC1CC[N+]2(CCCC2)C1)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H32NO3/c24-21(26-20-13-16-23(17-20)14-7-8-15-23)22(25,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1,3-4,9-10,19-20,25H,2,5-8,11-17H2/q+1 |
| InChIKey | AYGYJDXBBKZOJL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|