C19H28INO3 — CID 76974252
[1-methyl-1-(trideuterio(113C)methyl)pyrrolidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate iodide (PubChem CID 76974252) has the molecular formula C19H28INO3 and a molecular weight of 449.35 g/mol. Its IUPAC name is [1-methyl-1-(trideuterio(113C)methyl)pyrrolidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate iodide.
| Compound Name | [1-methyl-1-(trideuterio(113C)methyl)pyrrolidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate iodide |
|---|---|
| PubChem CID | 76974252 |
| Molecular Formula | C19H28INO3 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | [1-methyl-1-(trideuterio(113C)methyl)pyrrolidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate iodide |
| SMILES | [2H][13C]([2H])([2H])[N+]1(C)CCC(OC(=O)C(O)(c2ccccc2)C2CCCC2)C1.[I-] |
| InChI | InChI=1S/C19H28NO3.HI/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15;/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3;1H/q+1;/p-1/i1+1D3; |
| InChIKey | MDXIQDYNAVSOAZ-SPZGMPHYSA-M |
| XLogP | -0.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|