C21H30BrNO3 — CID 3059297
5-azoniaspiro[4.4]nonan-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (PubChem CID 3059297) has the molecular formula C21H30BrNO3 and a molecular weight of 424.38 g/mol. Its IUPAC name is 5-azoniaspiro[4.4]nonan-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide.
| Compound Name | 5-azoniaspiro[4.4]nonan-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 3059297 |
| Molecular Formula | C21H30BrNO3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 5-azoniaspiro[4.4]nonan-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| SMILES | O=C(OC1CC[N+]2(CCCC2)C1)C(O)(c1ccccc1)C1CCCC1.[Br-] |
| InChI | InChI=1S/C21H30NO3.BrH/c23-20(25-19-12-15-22(16-19)13-6-7-14-22)21(24,18-10-4-5-11-18)17-8-2-1-3-9-17;/h1-3,8-9,18-19,24H,4-7,10-16H2;1H/q+1;/p-1 |
| InChIKey | GTUXEJNOHYZMBF-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|