C23H32NO7+ — CID 23726013
(Z)-but-2-enedioic acid;(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 23726013) has the molecular formula C23H32NO7+ and a molecular weight of 434.51 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | (Z)-but-2-enedioic acid;(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 23726013 |
| Molecular Formula | C23H32NO7+ |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(C)CCC(OC(=O)C(O)(c2ccccc2)C2CCCC2)C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H28NO3.C4H4O4/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15;5-3(6)1-2-4(7)8/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/q+1;/b;2-1- |
| InChIKey | YKTVLJIMDSEQND-BTJKTKAUSA-N |
| XLogP | 2.17 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|