C26H33NO5 — CID 23726017
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate benzoate (PubChem CID 23726017) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate benzoate.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate benzoate |
|---|---|
| PubChem CID | 23726017 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate benzoate |
| SMILES | C[N+]1(C)CCC(OC(=O)C(O)(c2ccccc2)C2CCCC2)C1.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C19H28NO3.C7H6O2/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15;8-7(9)6-4-2-1-3-5-6/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3;1-5H,(H,8,9)/q+1;/p-1 |
| InChIKey | QPPZTRBXKMVYIL-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|