C23H40NO3+ — CID 70591199
5-azoniaspiro[4.5]decan-3-yl 2,2-dicyclohexyl-2-hydroxyacetate (PubChem CID 70591199) has the molecular formula C23H40NO3+ and a molecular weight of 378.58 g/mol. Its IUPAC name is 5-azoniaspiro[4.5]decan-3-yl 2,2-dicyclohexyl-2-hydroxyacetate.
| Compound Name | 5-azoniaspiro[4.5]decan-3-yl 2,2-dicyclohexyl-2-hydroxyacetate |
|---|---|
| PubChem CID | 70591199 |
| Molecular Formula | C23H40NO3+ |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 5-azoniaspiro[4.5]decan-3-yl 2,2-dicyclohexyl-2-hydroxyacetate |
| SMILES | O=C(OC1CC[N+]2(CCCCC2)C1)C(O)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H40NO3/c25-22(27-21-14-17-24(18-21)15-8-3-9-16-24)23(26,19-10-4-1-5-11-19)20-12-6-2-7-13-20/h19-21,26H,1-18H2/q+1 |
| InChIKey | KPPHNAQRURHWRJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|