C19H30NO3+ — CID 20697386
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclohexa-2,4-dien-1-yl-2-cyclopentyl-2-hydroxyacetate (PubChem CID 20697386) has the molecular formula C19H30NO3+ and a molecular weight of 320.45 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclohexa-2,4-dien-1-yl-2-cyclopentyl-2-hydroxyacetate.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclohexa-2,4-dien-1-yl-2-cyclopentyl-2-hydroxyacetate |
|---|---|
| PubChem CID | 20697386 |
| Molecular Formula | C19H30NO3+ |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclohexa-2,4-dien-1-yl-2-cyclopentyl-2-hydroxyacetate |
| SMILES | C[N+]1(C)CCC(OC(=O)C(O)(C2C=CC=CC2)C2CCCC2)C1 |
| InChI | InChI=1S/C19H30NO3/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15/h3-5,8,15-17,22H,6-7,9-14H2,1-2H3/q+1 |
| InChIKey | UBLBBDVQLFSPMV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|