C20H24BrNO3 — CID 76965754
[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate bromide (PubChem CID 76965754) has the molecular formula C20H24BrNO3 and a molecular weight of 406.32 g/mol. Its IUPAC name is [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate bromide.
| Compound Name | [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
|---|---|
| PubChem CID | 76965754 |
| Molecular Formula | C20H24BrNO3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
| SMILES | C[N+]1(C)CC[C@@H](OC(=O)C(O)(c2ccccc2)c2ccccc2)C1.[Br-] |
| InChI | InChI=1S/C20H24NO3.BrH/c1-21(2)14-13-18(15-21)24-19(22)20(23,16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-12,18,23H,13-15H2,1-2H3;1H/q+1;/p-1/t18-;/m1./s1 |
| InChIKey | GXDDWKSWODZCSV-GMUIIQOCSA-M |
| XLogP | -0.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|