C21H32NO2+ — CID 11998262
[(3R)-1,1-dimethylpiperidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-phenylpropanoate (PubChem CID 11998262) has the molecular formula C21H32NO2+ and a molecular weight of 330.49 g/mol. Its IUPAC name is [(3R)-1,1-dimethylpiperidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-phenylpropanoate.
| Compound Name | [(3R)-1,1-dimethylpiperidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 11998262 |
| Molecular Formula | C21H32NO2+ |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(3R)-1,1-dimethylpiperidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-phenylpropanoate |
| SMILES | C[C@@](C(=O)O[C@@H]1CCC[N+](C)(C)C1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C21H32NO2/c1-21(18-12-7-8-13-18,17-10-5-4-6-11-17)20(23)24-19-14-9-15-22(2,3)16-19/h4-6,10-11,18-19H,7-9,12-16H2,1-3H3/q+1/t19-,21-/m1/s1 |
| InChIKey | DLDGOMORWCLPHU-TZIWHRDSSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|