C21H30NO4+ — CID 88530880
2-[3-[(2S)-2-cyclopentyl-2-phenylpropanoyl]oxy-1-methylpyrrolidin-1-ium-1-yl]acetic acid (PubChem CID 88530880) has the molecular formula C21H30NO4+ and a molecular weight of 360.47 g/mol. Its IUPAC name is 2-[3-[(2S)-2-cyclopentyl-2-phenylpropanoyl]oxy-1-methylpyrrolidin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[3-[(2S)-2-cyclopentyl-2-phenylpropanoyl]oxy-1-methylpyrrolidin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 88530880 |
| Molecular Formula | C21H30NO4+ |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-[3-[(2S)-2-cyclopentyl-2-phenylpropanoyl]oxy-1-methylpyrrolidin-1-ium-1-yl]acetic acid |
| SMILES | C[C@@](C(=O)OC1CC[N+](C)(CC(=O)O)C1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C21H29NO4/c1-21(17-10-6-7-11-17,16-8-4-3-5-9-16)20(25)26-18-12-13-22(2,14-18)15-19(23)24/h3-5,8-9,17-18H,6-7,10-15H2,1-2H3/p+1/t18?,21-,22?/m1/s1 |
| InChIKey | AZPZHGQLFPXPMA-NFOQDIRWSA-O |
| XLogP | 2.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|