C26H40NO5+ — CID 11706365
[(1R,3S)-1-(2-hexoxy-2-oxoethyl)-1-methylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 11706365) has the molecular formula C26H40NO5+ and a molecular weight of 446.61 g/mol. Its IUPAC name is [(1R,3S)-1-(2-hexoxy-2-oxoethyl)-1-methylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(1R,3S)-1-(2-hexoxy-2-oxoethyl)-1-methylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 11706365 |
| Molecular Formula | C26H40NO5+ |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | [(1R,3S)-1-(2-hexoxy-2-oxoethyl)-1-methylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | CCCCCCOC(=O)C[N@+]1(C)CC[C@H](OC(=O)[C@](O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C26H40NO5/c1-3-4-5-11-18-31-24(28)20-27(2)17-16-23(19-27)32-25(29)26(30,22-14-9-10-15-22)21-12-7-6-8-13-21/h6-8,12-13,22-23,30H,3-5,9-11,14-20H2,1-2H3/q+1/t23-,26-,27+/m0/s1 |
| InChIKey | WGFDKSIXZVBGOS-MSLLRLGPSA-N |
| XLogP | 3.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|