C33H40NO4+ — CID 69478317
[1-methyl-1-[3-(4-phenylphenoxy)propyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 69478317) has the molecular formula C33H40NO4+ and a molecular weight of 514.69 g/mol. Its IUPAC name is [1-methyl-1-[3-(4-phenylphenoxy)propyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-methyl-1-[3-(4-phenylphenoxy)propyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 69478317 |
| Molecular Formula | C33H40NO4+ |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | [1-methyl-1-[3-(4-phenylphenoxy)propyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(CCCOc2ccc(-c3ccccc3)cc2)CCC(OC(=O)[C@](O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C33H40NO4/c1-34(22-10-24-37-30-19-17-27(18-20-30)26-11-4-2-5-12-26)23-21-31(25-34)38-32(35)33(36,29-15-8-9-16-29)28-13-6-3-7-14-28/h2-7,11-14,17-20,29,31,36H,8-10,15-16,21-25H2,1H3/q+1/t31?,33-,34?/m0/s1 |
| InChIKey | VKJXLQVKQHKGHT-VOTNUIJPSA-N |
| XLogP | 5.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|