C28H38BrNO3 — CID 66902412
[1-methyl-1-(3-phenylpropyl)piperidin-1-ium-4-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (PubChem CID 66902412) has the molecular formula C28H38BrNO3 and a molecular weight of 516.52 g/mol. Its IUPAC name is [1-methyl-1-(3-phenylpropyl)piperidin-1-ium-4-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide.
| Compound Name | [1-methyl-1-(3-phenylpropyl)piperidin-1-ium-4-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 66902412 |
| Molecular Formula | C28H38BrNO3 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | [1-methyl-1-(3-phenylpropyl)piperidin-1-ium-4-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| SMILES | C[N+]1(CCCc2ccccc2)CCC(OC(=O)[C@](O)(c2ccccc2)C2CCCC2)CC1.[Br-] |
| InChI | InChI=1S/C28H38NO3.BrH/c1-29(20-10-13-23-11-4-2-5-12-23)21-18-26(19-22-29)32-27(30)28(31,25-16-8-9-17-25)24-14-6-3-7-15-24;/h2-7,11-12,14-15,25-26,31H,8-10,13,16-22H2,1H3;1H/q+1;/p-1/t26?,28-,29?;/m0./s1 |
| InChIKey | QETMOMDJQZZOCA-NOWWTIMUSA-M |
| XLogP | 1.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|