C28H37NO3 — CID 11697800
1-cyclopentyl-2-[(1R)-1-methyl-1-(3-phenylpropyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate (PubChem CID 11697800) has the molecular formula C28H37NO3 and a molecular weight of 435.61 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(1R)-1-methyl-1-(3-phenylpropyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate.
| Compound Name | 1-cyclopentyl-2-[(1R)-1-methyl-1-(3-phenylpropyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate |
|---|---|
| PubChem CID | 11697800 |
| Molecular Formula | C28H37NO3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 1-cyclopentyl-2-[(1R)-1-methyl-1-(3-phenylpropyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate |
| SMILES | C[N@@+]1(CCCc2ccccc2)CCCC(OC(=O)C([O-])(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C28H37NO3/c1-29(20-10-14-23-12-4-2-5-13-23)21-11-19-26(22-29)32-27(30)28(31,25-17-8-9-18-25)24-15-6-3-7-16-24/h2-7,12-13,15-16,25-26H,8-11,14,17-22H2,1H3/t26?,28?,29-/m1/s1 |
| InChIKey | GDNOSZSYELDZCT-UYTNTSMZSA-N |
| XLogP | 4.22 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|