C26H35N3O3 — CID 11561198
1-cyclohexyl-2-[(1R)-1-methyl-1-(2-pyrimidin-5-ylethyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate (PubChem CID 11561198) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(1R)-1-methyl-1-(2-pyrimidin-5-ylethyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate.
| Compound Name | 1-cyclohexyl-2-[(1R)-1-methyl-1-(2-pyrimidin-5-ylethyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate |
|---|---|
| PubChem CID | 11561198 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 1-cyclohexyl-2-[(1R)-1-methyl-1-(2-pyrimidin-5-ylethyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate |
| SMILES | C[N@+]1(CCc2cncnc2)CCCC(OC(=O)C([O-])(c2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C26H35N3O3/c1-29(16-14-21-17-27-20-28-18-21)15-8-13-24(19-29)32-25(30)26(31,22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2,4-5,9-10,17-18,20,23-24H,3,6-8,11-16,19H2,1H3/t24?,26?,29-/m1/s1 |
| InChIKey | ACEKBTWUODKYPF-LXNFMVHRSA-N |
| XLogP | 3.01 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|