C27H38N3O3+ — CID 66902164
[(3R)-1-methyl-1-(3-pyrimidin-5-ylpropyl)piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 66902164) has the molecular formula C27H38N3O3+ and a molecular weight of 452.62 g/mol. Its IUPAC name is [(3R)-1-methyl-1-(3-pyrimidin-5-ylpropyl)piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(3R)-1-methyl-1-(3-pyrimidin-5-ylpropyl)piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 66902164 |
| Molecular Formula | C27H38N3O3+ |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | [(3R)-1-methyl-1-(3-pyrimidin-5-ylpropyl)piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(CCCc2cncnc2)CCC[C@@H](OC(=O)C(O)(c2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C27H38N3O3/c1-30(16-8-10-22-18-28-21-29-19-22)17-9-15-25(20-30)33-26(31)27(32,23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2,4-5,11-12,18-19,21,24-25,32H,3,6-10,13-17,20H2,1H3/q+1/t25-,27?,30?/m1/s1 |
| InChIKey | JJPNPSNSTGQFQF-WUXOVTSDSA-N |
| XLogP | 4.03 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|