C25H35N2O4+ — CID 11597081
[(1R)-1-methyl-1-[2-(1,2-oxazol-3-yl)ethyl]piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 11597081) has the molecular formula C25H35N2O4+ and a molecular weight of 427.57 g/mol. Its IUPAC name is [(1R)-1-methyl-1-[2-(1,2-oxazol-3-yl)ethyl]piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(1R)-1-methyl-1-[2-(1,2-oxazol-3-yl)ethyl]piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 11597081 |
| Molecular Formula | C25H35N2O4+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | [(1R)-1-methyl-1-[2-(1,2-oxazol-3-yl)ethyl]piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N@+]1(CCc2ccon2)CCCC(OC(=O)C(O)(c2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C25H35N2O4/c1-27(17-14-22-15-18-30-26-22)16-8-13-23(19-27)31-24(28)25(29,20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2,4-5,9-10,15,18,21,23,29H,3,6-8,11-14,16-17,19H2,1H3/q+1/t23?,25?,27-/m1/s1 |
| InChIKey | ASGDOZZFRMPGJU-RMBIHJOLSA-N |
| XLogP | 3.84 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|