C26H31N2O4+ — CID 66902428
[1-methyl-1-[3-(1,2-oxazol-3-yl)propyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 66902428) has the molecular formula C26H31N2O4+ and a molecular weight of 435.54 g/mol. Its IUPAC name is [1-methyl-1-[3-(1,2-oxazol-3-yl)propyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [1-methyl-1-[3-(1,2-oxazol-3-yl)propyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 66902428 |
| Molecular Formula | C26H31N2O4+ |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | [1-methyl-1-[3-(1,2-oxazol-3-yl)propyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(CCCc2ccon2)CCCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H31N2O4/c1-28(17-8-14-23-16-19-31-27-23)18-9-15-24(20-28)32-25(29)26(30,21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-7,10-13,16,19,24,30H,8-9,14-15,17-18,20H2,1H3/q+1 |
| InChIKey | SCIDHRINFMVBON-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|