C26H30N3O3+ — CID 66902773
[(3R)-1-methyl-1-(2-pyrimidin-2-ylethyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 66902773) has the molecular formula C26H30N3O3+ and a molecular weight of 432.54 g/mol. Its IUPAC name is [(3R)-1-methyl-1-(2-pyrimidin-2-ylethyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-methyl-1-(2-pyrimidin-2-ylethyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 66902773 |
| Molecular Formula | C26H30N3O3+ |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [(3R)-1-methyl-1-(2-pyrimidin-2-ylethyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(CCc2ncccn2)CCC[C@@H](OC(=O)C(O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H30N3O3/c1-29(19-15-24-27-16-9-17-28-24)18-8-14-23(20-29)32-25(30)26(31,21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-7,9-13,16-17,23,31H,8,14-15,18-20H2,1H3/q+1/t23-,29?/m1/s1 |
| InChIKey | DYCKCTFGQZVKTO-WIZGVZBGSA-N |
| XLogP | 3.11 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|