C27H36N2O3 — CID 11597289
1-cyclohexyl-2-[(1R)-1-methyl-1-(2-pyridin-2-ylethyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate (PubChem CID 11597289) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(1R)-1-methyl-1-(2-pyridin-2-ylethyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate.
| Compound Name | 1-cyclohexyl-2-[(1R)-1-methyl-1-(2-pyridin-2-ylethyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate |
|---|---|
| PubChem CID | 11597289 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 1-cyclohexyl-2-[(1R)-1-methyl-1-(2-pyridin-2-ylethyl)piperidin-1-ium-3-yl]oxy-2-oxo-1-phenylethanolate |
| SMILES | C[N@+]1(CCc2ccccn2)CCCC(OC(=O)C([O-])(c2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C27H36N2O3/c1-29(20-17-24-15-8-9-18-28-24)19-10-16-25(21-29)32-26(30)27(31,22-11-4-2-5-12-22)23-13-6-3-7-14-23/h2,4-5,8-9,11-12,15,18,23,25H,3,6-7,10,13-14,16-17,19-21H2,1H3/t25?,27?,29-/m1/s1 |
| InChIKey | ZOVQFROYYRAVSP-CICLSPSMSA-N |
| XLogP | 3.61 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|