C27H37N2O3+ — CID 66902363
[1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 66902363) has the molecular formula C27H37N2O3+ and a molecular weight of 437.60 g/mol. Its IUPAC name is [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 66902363 |
| Molecular Formula | C27H37N2O3+ |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [1-methyl-1-(3-pyridin-2-ylpropyl)piperidin-1-ium-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(CCCc2ccccn2)CCCC(OC(=O)C(O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C27H37N2O3/c1-29(19-9-16-24-15-7-8-18-28-24)20-10-17-25(21-29)32-26(30)27(31,23-13-5-6-14-23)22-11-3-2-4-12-22/h2-4,7-8,11-12,15,18,23,25,31H,5-6,9-10,13-14,16-17,19-21H2,1H3/q+1 |
| InChIKey | MGLSMGVAEJHWGA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|