C26H29N4O4+ — CID 73046138
[1-methyl-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 73046138) has the molecular formula C26H29N4O4+ and a molecular weight of 461.54 g/mol. Its IUPAC name is [1-methyl-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [1-methyl-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 73046138 |
| Molecular Formula | C26H29N4O4+ |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [1-methyl-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(CC(=O)Nc2ccncn2)CCCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H28N4O4/c1-30(18-24(31)29-23-14-15-27-19-28-23)16-8-13-22(17-30)34-25(32)26(33,20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,14-15,19,22,33H,8,13,16-18H2,1H3/p+1 |
| InChIKey | TXUNLQINWGYXIN-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|