C26H30N3O5+ — CID 73070176
[1-methyl-1-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 73070176) has the molecular formula C26H30N3O5+ and a molecular weight of 464.54 g/mol. Its IUPAC name is [1-methyl-1-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [1-methyl-1-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 73070176 |
| Molecular Formula | C26H30N3O5+ |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | [1-methyl-1-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | Cc1cc(NC(=O)C[N+]2(C)CCCC(OC(=O)C(O)(c3ccccc3)c3ccccc3)C2)no1 |
| InChI | InChI=1S/C26H29N3O5/c1-19-16-23(28-34-19)27-24(30)18-29(2)15-9-14-22(17-29)33-25(31)26(32,20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,16,22,32H,9,14-15,17-18H2,1-2H3/p+1 |
| InChIKey | SVPBPBRMGMSCAX-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|