C24H26BrN5O4 — CID 89412333
[1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate bromide (PubChem CID 89412333) has the molecular formula C24H26BrN5O4 and a molecular weight of 528.41 g/mol. Its IUPAC name is [1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate bromide.
| Compound Name | [1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
|---|---|
| PubChem CID | 89412333 |
| Molecular Formula | C24H26BrN5O4 |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
| SMILES | C[N+]1(CC(=O)Nc2ncncn2)CCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)C1.[Br-] |
| InChI | InChI=1S/C24H25N5O4.BrH/c1-29(15-21(30)28-23-26-16-25-17-27-23)13-12-20(14-29)33-22(31)24(32,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,16-17,20,32H,12-15H2,1H3;1H |
| InChIKey | HPGCPJGPHLLDQM-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|