C27H29N4O4+ — CID 87422338
[(3R)-1-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 87422338) has the molecular formula C27H29N4O4+ and a molecular weight of 473.55 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 87422338 |
| Molecular Formula | C27H29N4O4+ |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)Nc1ncccn1 |
| InChI | InChI=1S/C27H28N4O4/c32-24(30-26-28-14-7-15-29-26)19-31-16-12-20(13-17-31)23(18-31)35-25(33)27(34,21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-11,14-15,20,23,34H,12-13,16-19H2/p+1/t20?,23-,31?/m0/s1 |
| InChIKey | KBCWFLUUINRWCV-ZITBFLLYSA-O |
| XLogP | 2.50 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|