C26H33BrN4O4 — CID 11656809
[(3R)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (PubChem CID 11656809) has the molecular formula C26H33BrN4O4 and a molecular weight of 545.48 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide.
| Compound Name | [(3R)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 11656809 |
| Molecular Formula | C26H33BrN4O4 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)C1CCCC1)C2)Nc1cnccn1.[Br-] |
| InChI | InChI=1S/C26H32N4O4.BrH/c31-24(29-23-16-27-12-13-28-23)18-30-14-10-19(11-15-30)22(17-30)34-25(32)26(33,21-8-4-5-9-21)20-6-2-1-3-7-20;/h1-3,6-7,12-13,16,19,21-22,33H,4-5,8-11,14-15,17-18H2;1H/t19?,22-,26?,30?;/m0./s1 |
| InChIKey | DQWQUUWAYXIMGT-ZVPZRTFFSA-N |
| XLogP | -0.35 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|