C13H19N4O2+ — CID 86627864
2-[(3R)-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]-N-pyrazin-2-ylacetamide (PubChem CID 86627864) has the molecular formula C13H19N4O2+ and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-[(3R)-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]-N-pyrazin-2-ylacetamide.
| Compound Name | 2-[(3R)-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]-N-pyrazin-2-ylacetamide |
|---|---|
| PubChem CID | 86627864 |
| Molecular Formula | C13H19N4O2+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-[(3R)-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]-N-pyrazin-2-ylacetamide |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](O)C2)Nc1cnccn1 |
| InChI | InChI=1S/C13H18N4O2/c18-11-8-17(5-1-10(11)2-6-17)9-13(19)16-12-7-14-3-4-15-12/h3-4,7,10-11,18H,1-2,5-6,8-9H2/p+1/t10?,11-,17?/m0/s1 |
| InChIKey | QHBXSBLEMPMCEU-GCULGPDHSA-O |
| XLogP | 0.02 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|