C27H36N5O3+ — CID 24999224
[(3S)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 24999224) has the molecular formula C27H36N5O3+ and a molecular weight of 478.62 g/mol. Its IUPAC name is [(3S)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3S)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 24999224 |
| Molecular Formula | C27H36N5O3+ |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | [(3S)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | C[C@@](C(=O)O[C@@H]1C[N+]2(CC(=O)Nc3cnccn3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C27H35N5O3/c1-27(22-8-4-2-5-9-22,31-14-6-3-7-15-31)26(34)35-23-19-32(16-10-21(23)11-17-32)20-25(33)30-24-18-28-12-13-29-24/h2,4-5,8-9,12-13,18,21,23H,3,6-7,10-11,14-17,19-20H2,1H3/p+1/t21?,23-,27+,32?/m1/s1 |
| InChIKey | HBESSADZMVANJT-YVAILVNOSA-O |
| XLogP | 2.97 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|