C30H38N5O3+ — CID 59316282
[(3R)-1-[2-(1H-indazol-5-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 59316282) has the molecular formula C30H38N5O3+ and a molecular weight of 516.67 g/mol. Its IUPAC name is [(3R)-1-[2-(1H-indazol-5-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3R)-1-[2-(1H-indazol-5-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 59316282 |
| Molecular Formula | C30H38N5O3+ |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | [(3R)-1-[2-(1H-indazol-5-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | CC(C(=O)O[C@H]1C[N+]2(CC(=O)Nc3ccc4[nH]ncc4c3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C30H37N5O3/c1-30(24-8-4-2-5-9-24,34-14-6-3-7-15-34)29(37)38-27-20-35(16-12-22(27)13-17-35)21-28(36)32-25-10-11-26-23(18-25)19-31-33-26/h2,4-5,8-11,18-19,22,27H,3,6-7,12-17,20-21H2,1H3,(H-,31,32,33,36)/p+1/t22?,27-,30?,35?/m0/s1 |
| InChIKey | HCRYPNLAJSJPJI-NTSYFCEJSA-O |
| XLogP | 4.05 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|