C28H38N3O3+ — CID 57392514
[(3R)-1-(2-pyridin-4-yloxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 57392514) has the molecular formula C28H38N3O3+ and a molecular weight of 464.63 g/mol. Its IUPAC name is [(3R)-1-(2-pyridin-4-yloxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3R)-1-(2-pyridin-4-yloxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 57392514 |
| Molecular Formula | C28H38N3O3+ |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | [(3R)-1-(2-pyridin-4-yloxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | C[C@@](C(=O)O[C@H]1C[N+]2(CCOc3ccncc3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C28H38N3O3/c1-28(24-8-4-2-5-9-24,30-16-6-3-7-17-30)27(32)34-26-22-31(18-12-23(26)13-19-31)20-21-33-25-10-14-29-15-11-25/h2,4-5,8-11,14-15,23,26H,3,6-7,12-13,16-22H2,1H3/q+1/t23?,26-,28-,31?/m0/s1 |
| InChIKey | FJOACQNMBCLIDI-PCUONRJLSA-N |
| XLogP | 4.01 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|