C31H38ClN3O3 — CID 44555810
[(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-phenyl-2-piperidin-1-ylpropanoate chloride (PubChem CID 44555810) has the molecular formula C31H38ClN3O3 and a molecular weight of 536.12 g/mol. Its IUPAC name is [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-phenyl-2-piperidin-1-ylpropanoate chloride.
| Compound Name | [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-phenyl-2-piperidin-1-ylpropanoate chloride |
|---|---|
| PubChem CID | 44555810 |
| Molecular Formula | C31H38ClN3O3 |
| Molecular Weight | 536.12 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-phenyl-2-piperidin-1-ylpropanoate chloride |
| SMILES | C[C@](C(=O)O[C@H]1C[N+]2(Cc3coc(-c4ccccc4)n3)CCC1CC2)(c1ccccc1)N1CCCCC1.[Cl-] |
| InChI | InChI=1S/C31H38N3O3.ClH/c1-31(26-13-7-3-8-14-26,33-17-9-4-10-18-33)30(35)37-28-22-34(19-15-24(28)16-20-34)21-27-23-36-29(32-27)25-11-5-2-6-12-25;/h2-3,5-8,11-14,23-24,28H,4,9-10,15-22H2,1H3;1H/q+1;/p-1/t24?,28-,31+,34?;/m0./s1 |
| InChIKey | LNZSLBCNLMLTIP-VBQAZKNRSA-M |
| XLogP | 2.40 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|