C31H38N3O3+ — CID 89121140
[(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 89121140) has the molecular formula C31H38N3O3+ and a molecular weight of 500.66 g/mol. Its IUPAC name is [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 89121140 |
| Molecular Formula | C31H38N3O3+ |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | C[C@@](C(=O)O[C@H]1C[N+]2(Cc3coc(-c4ccccc4)n3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C31H38N3O3/c1-31(26-13-7-3-8-14-26,33-17-9-4-10-18-33)30(35)37-28-22-34(19-15-24(28)16-20-34)21-27-23-36-29(32-27)25-11-5-2-6-12-25/h2-3,5-8,11-14,23-24,28H,4,9-10,15-22H2,1H3/q+1/t24?,28-,31-,34?/m0/s1 |
| InChIKey | FACCJMJYMBPSFE-YAFCZHNFSA-N |
| XLogP | 5.40 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|