C26H34N4O4 — CID 24998611
N-(1,2-oxazol-3-yl)-2-[(3S)-3-[(2S)-2-phenyl-2-piperidin-1-ylpropanoyl]oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanimidate (PubChem CID 24998611) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-(1,2-oxazol-3-yl)-2-[(3S)-3-[(2S)-2-phenyl-2-piperidin-1-ylpropanoyl]oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanimidate.
| Compound Name | N-(1,2-oxazol-3-yl)-2-[(3S)-3-[(2S)-2-phenyl-2-piperidin-1-ylpropanoyl]oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanimidate |
|---|---|
| PubChem CID | 24998611 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | N-(1,2-oxazol-3-yl)-2-[(3S)-3-[(2S)-2-phenyl-2-piperidin-1-ylpropanoyl]oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanimidate |
| SMILES | C[C@@](C(=O)O[C@@H]1C[N+]2(C/C([O-])=N/c3ccon3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C26H34N4O4/c1-26(21-8-4-2-5-9-21,29-13-6-3-7-14-29)25(32)34-22-18-30(15-10-20(22)11-16-30)19-24(31)27-23-12-17-33-28-23/h2,4-5,8-9,12,17,20,22H,3,6-7,10-11,13-16,18-19H2,1H3/t20?,22-,26+,30?/m1/s1 |
| InChIKey | FWGZCGKLVODFPY-ROPUDZRTSA-N |
| XLogP | 2.62 |
| TPSA | 90.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|