C24H32N4O4S — CID 25002122
N-(1,2-oxazol-3-yl)-2-[(3S)-3-(2-piperidin-1-yl-2-thiophen-2-ylpropanoyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanimidate (PubChem CID 25002122) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-(1,2-oxazol-3-yl)-2-[(3S)-3-(2-piperidin-1-yl-2-thiophen-2-ylpropanoyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanimidate.
| Compound Name | N-(1,2-oxazol-3-yl)-2-[(3S)-3-(2-piperidin-1-yl-2-thiophen-2-ylpropanoyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanimidate |
|---|---|
| PubChem CID | 25002122 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-(1,2-oxazol-3-yl)-2-[(3S)-3-(2-piperidin-1-yl-2-thiophen-2-ylpropanoyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanimidate |
| SMILES | CC(C(=O)O[C@@H]1C[N+]2(C/C([O-])=N/c3ccon3)CCC1CC2)(c1cccs1)N1CCCCC1 |
| InChI | InChI=1S/C24H32N4O4S/c1-24(20-6-5-15-33-20,27-10-3-2-4-11-27)23(30)32-19-16-28(12-7-18(19)8-13-28)17-22(29)25-21-9-14-31-26-21/h5-6,9,14-15,18-19H,2-4,7-8,10-13,16-17H2,1H3/t18?,19-,24?,28?/m1/s1 |
| InChIKey | STBUKKKWQRDACN-WMXQZYLISA-N |
| XLogP | 2.68 |
| TPSA | 90.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|