C25H33N4O4S+ — CID 59316289
[(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate (PubChem CID 59316289) has the molecular formula C25H33N4O4S+ and a molecular weight of 485.63 g/mol. Its IUPAC name is [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate.
| Compound Name | [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 59316289 |
| Molecular Formula | C25H33N4O4S+ |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-thiomorpholin-4-ylpropanoate |
| SMILES | CC(C(=O)O[C@H]1C[N+]2(CC(=O)Nc3ccon3)CCC1CC2)(c1ccccc1)N1CCSCC1 |
| InChI | InChI=1S/C25H32N4O4S/c1-25(20-5-3-2-4-6-20,28-10-15-34-16-11-28)24(31)33-21-17-29(12-7-19(21)8-13-29)18-23(30)26-22-9-14-32-27-22/h2-6,9,14,19,21H,7-8,10-13,15-18H2,1H3/p+1/t19?,21-,25?,29?/m0/s1 |
| InChIKey | CFNPNMRTNOMPND-SQJIEPIVSA-O |
| XLogP | 2.73 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|