C29H37BrN2O3 — CID 87509091
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate bromide (PubChem CID 87509091) has the molecular formula C29H37BrN2O3 and a molecular weight of 541.53 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate bromide.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate bromide |
|---|---|
| PubChem CID | 87509091 |
| Molecular Formula | C29H37BrN2O3 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate bromide |
| SMILES | C[C@@](C(=O)O[C@H]1C[N+]2(CC(=O)c3ccccc3)CCC1CC2)(c1ccccc1)N1CCCCC1.[Br-] |
| InChI | InChI=1S/C29H37N2O3.BrH/c1-29(25-13-7-3-8-14-25,30-17-9-4-10-18-30)28(33)34-27-22-31(19-15-24(27)16-20-31)21-26(32)23-11-5-2-6-12-23;/h2-3,5-8,11-14,24,27H,4,9-10,15-22H2,1H3;1H/q+1;/p-1/t24?,27-,29-,31?;/m0./s1 |
| InChIKey | PYCOKEVYHSZQCI-AHMVKAKYSA-M |
| XLogP | 1.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|