C29H39N2O3+ — CID 57399408
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 57399408) has the molecular formula C29H39N2O3+ and a molecular weight of 463.64 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 57399408 |
| Molecular Formula | C29H39N2O3+ |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | C[C@@](C(=O)O[C@H]1C[N+]2(CCOc3ccccc3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C29H39N2O3/c1-29(25-11-5-2-6-12-25,30-17-9-4-10-18-30)28(32)34-27-23-31(19-15-24(27)16-20-31)21-22-33-26-13-7-3-8-14-26/h2-3,5-8,11-14,24,27H,4,9-10,15-23H2,1H3/q+1/t24?,27-,29-,31?/m0/s1 |
| InChIKey | OBJDKIORAOGSLE-NAZCUKFVSA-N |
| XLogP | 4.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|