C29H30N3O6+ — CID 87422410
[(3R)-1-[2-(4-nitroanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 87422410) has the molecular formula C29H30N3O6+ and a molecular weight of 516.57 g/mol. Its IUPAC name is [(3R)-1-[2-(4-nitroanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-[2-(4-nitroanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 87422410 |
| Molecular Formula | C29H30N3O6+ |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [(3R)-1-[2-(4-nitroanilino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H29N3O6/c33-27(30-24-11-13-25(14-12-24)31(36)37)20-32-17-15-21(16-18-32)26(19-32)38-28(34)29(35,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,21,26,35H,15-20H2/p+1/t21?,26-,32?/m0/s1 |
| InChIKey | UMPUQPVIKFJFNM-DTOGRTORSA-O |
| XLogP | 3.62 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|