C31H36NO3+ — CID 66592473
[(3R)-1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-bis(4-methylphenyl)acetate (PubChem CID 66592473) has the molecular formula C31H36NO3+ and a molecular weight of 470.63 g/mol. Its IUPAC name is [(3R)-1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-bis(4-methylphenyl)acetate.
| Compound Name | [(3R)-1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-bis(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 66592473 |
| Molecular Formula | C31H36NO3+ |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | [(3R)-1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-bis(4-methylphenyl)acetate |
| SMILES | Cc1ccc(C(O)(C(=O)O[C@H]2C[N+]3(CCc4ccccc4)CCC2CC3)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H36NO3/c1-23-8-12-27(13-9-23)31(34,28-14-10-24(2)11-15-28)30(33)35-29-22-32(20-17-26(29)18-21-32)19-16-25-6-4-3-5-7-25/h3-15,26,29,34H,16-22H2,1-2H3/q+1/t26?,29-,32?/m0/s1 |
| InChIKey | PFDJJSUFLPJUCP-IIIFQBMYSA-N |
| XLogP | 4.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|